C32H27ClN6OS2 — CID 90484936
3-[[(5Z)-3-benzyl-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile;pyridine (PubChem CID 90484936) has the molecular formula C32H27ClN6OS2 and a molecular weight of 611.20 g/mol. Its IUPAC name is 3-[[(5Z)-3-benzyl-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile;pyridine.
| Compound Name | 3-[[(5Z)-3-benzyl-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile;pyridine |
|---|---|
| PubChem CID | 90484936 |
| Molecular Formula | C32H27ClN6OS2 |
| Molecular Weight | 611.20 g/mol |
| Exact Mass | 610.14 |
| IUPAC Name | 3-[[(5Z)-3-benzyl-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile;pyridine |
| SMILES | CCNc1ccc(C#N)cc1/N=C1\S/C(=C2\Sc3ccc(Cl)cc3N2C)C(=O)N1Cc1ccccc1.c1ccncc1 |
| InChI | InChI=1S/C27H22ClN5OS2.C5H5N/c1-3-30-20-11-9-18(15-29)13-21(20)31-27-33(16-17-7-5-4-6-8-17)25(34)24(36-27)26-32(2)22-14-19(28)10-12-23(22)35-26;1-2-4-6-5-3-1/h4-14,30H,3,16H2,1-2H3;1-5H/b26-24-,31-27-; |
| InChIKey | YZKHOCOZMPLVPX-QWCDYURISA-N |
| XLogP | 7.90 |
| TPSA | 84.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.20 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|