C21H26ClNO4 — CID 90485288
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-6,7-diethoxy-1,2,3,4-tetrahydroisoquinoline;hydrochloride (PubChem CID 90485288) has the molecular formula C21H26ClNO4 and a molecular weight of 391.90 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-6,7-diethoxy-1,2,3,4-tetrahydroisoquinoline;hydrochloride.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-6,7-diethoxy-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
|---|---|
| PubChem CID | 90485288 |
| Molecular Formula | C21H26ClNO4 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-6,7-diethoxy-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| SMILES | CCOc1cc2c(cc1OCC)C(c1ccc3c(c1)OCCO3)NCC2.Cl |
| InChI | InChI=1S/C21H25NO4.ClH/c1-3-23-19-11-14-7-8-22-21(16(14)13-20(19)24-4-2)15-5-6-17-18(12-15)26-10-9-25-17;/h5-6,11-13,21-22H,3-4,7-10H2,1-2H3;1H |
| InChIKey | IRHPAHYGTDGCLQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |