About 6-amino-5-[2-(cyclohexylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride
6-amino-5-[2-(cyclohexylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride (PubChem CID 90485306) has the molecular formula C14H23ClN4O3
and a molecular weight of 330.82 g/mol. Its IUPAC name is 6-amino-5-[2-(cyclohexylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride.
Molecular Properties
| Compound Name | 6-amino-5-[2-(cyclohexylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride |
| PubChem CID | 90485306 |
| Molecular Formula | C14H23ClN4O3 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 6-amino-5-[2-(cyclohexylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride |
| SMILES | Cl.Cn1c(N)c(C(=O)CNC2CCCCC2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H22N4O3.ClH/c1-17-12(15)11(13(20)18(2)14(17)21)10(19)8-16-9-6-4-3-5-7-9;/h9,16H,3-8,15H2,1-2H3;1H |
| InChIKey | GEWSWQAMWQZIGW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-amino-5-[2-(cyclohexylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-[2-(cyclohexylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride?
The IUPAC name of 6-amino-5-[2-(cyclohexylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride (CID 90485306) is 6-amino-5-[2-(cyclohexylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride.
What is the SMILES notation for 6-amino-5-[2-(cyclohexylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride?
The canonical SMILES for 6-amino-5-[2-(cyclohexylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride is Cl.Cn1c(N)c(C(=O)CNC2CCCCC2)c(=O)n(C)c1=O.
What is the InChIKey of 6-amino-5-[2-(cyclohexylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride?
The InChIKey is GEWSWQAMWQZIGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O3.ClH/c1-17-12(15)11(13(20)18(2)14(17)21)10(19)8-16-9-6-4-3-5-7-9;/h9,16H,3-8,15H2,1-2H3;1H.
What are the key properties of 6-amino-5-[2-(cyclohexylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride?
6-amino-5-[2-(cyclohexylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride has a molecular weight of 330.82 g/mol, XLogP of 0.19, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-[2-(cyclohexylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride is sourced from PubChem (CID 90485306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).