C24H30ClN3O — CID 90485860
1-(2-ethylphenyl)-4-[1-(3-methylbutyl)benzimidazol-2-yl]pyrrolidin-2-one;hydrochloride (PubChem CID 90485860) has the molecular formula C24H30ClN3O and a molecular weight of 411.98 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-4-[1-(3-methylbutyl)benzimidazol-2-yl]pyrrolidin-2-one;hydrochloride.
| Compound Name | 1-(2-ethylphenyl)-4-[1-(3-methylbutyl)benzimidazol-2-yl]pyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 90485860 |
| Molecular Formula | C24H30ClN3O |
| Molecular Weight | 411.98 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 1-(2-ethylphenyl)-4-[1-(3-methylbutyl)benzimidazol-2-yl]pyrrolidin-2-one;hydrochloride |
| SMILES | CCc1ccccc1N1CC(c2nc3ccccc3n2CCC(C)C)CC1=O.Cl |
| InChI | InChI=1S/C24H29N3O.ClH/c1-4-18-9-5-7-11-21(18)27-16-19(15-23(27)28)24-25-20-10-6-8-12-22(20)26(24)14-13-17(2)3;/h5-12,17,19H,4,13-16H2,1-3H3;1H |
| InChIKey | FELSGCIBWRZLPS-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.98 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |