C26H29N3O8 — CID 90485918
N-[[5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl]-2-(2-methyl-1H-indol-3-yl)ethanamine;oxalic acid (PubChem CID 90485918) has the molecular formula C26H29N3O8 and a molecular weight of 511.53 g/mol. Its IUPAC name is N-[[5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl]-2-(2-methyl-1H-indol-3-yl)ethanamine;oxalic acid.
| Compound Name | N-[[5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl]-2-(2-methyl-1H-indol-3-yl)ethanamine;oxalic acid |
|---|---|
| PubChem CID | 90485918 |
| Molecular Formula | C26H29N3O8 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | N-[[5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl]-2-(2-methyl-1H-indol-3-yl)ethanamine;oxalic acid |
| SMILES | COc1cc(CC2CC(CNCCc3c(C)[nH]c4ccccc34)=NO2)cc2c1OCO2.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H27N3O4.C2H2O4/c1-15-19(20-5-3-4-6-21(20)26-15)7-8-25-13-17-12-18(31-27-17)9-16-10-22(28-2)24-23(11-16)29-14-30-24;3-1(4)2(5)6/h3-6,10-11,18,25-26H,7-9,12-14H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | ZWZGUQRTNJGRMB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|