C14H23IN2S — CID 90486025
4-methylsulfanylspiro[5,6,7,8-tetrahydro-1H-quinazoline-2,1'-cyclohexane];hydroiodide (PubChem CID 90486025) has the molecular formula C14H23IN2S and a molecular weight of 378.32 g/mol. Its IUPAC name is 4-methylsulfanylspiro[5,6,7,8-tetrahydro-1H-quinazoline-2,1'-cyclohexane];hydroiodide.
| Compound Name | 4-methylsulfanylspiro[5,6,7,8-tetrahydro-1H-quinazoline-2,1'-cyclohexane];hydroiodide |
|---|---|
| PubChem CID | 90486025 |
| Molecular Formula | C14H23IN2S |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 4-methylsulfanylspiro[5,6,7,8-tetrahydro-1H-quinazoline-2,1'-cyclohexane];hydroiodide |
| SMILES | CSC1=NC2(CCCCC2)NC2=C1CCCC2.I |
| InChI | InChI=1S/C14H22N2S.HI/c1-17-13-11-7-3-4-8-12(11)15-14(16-13)9-5-2-6-10-14;/h15H,2-10H2,1H3;1H |
| InChIKey | ZUFKKGCCDZLCHS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|