About 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propan-1-amine;hydrochloride
3-(4-bromo-3,5-dimethylpyrazol-1-yl)propan-1-amine;hydrochloride (PubChem CID 90486278) has the molecular formula C8H15BrClN3
and a molecular weight of 268.59 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propan-1-amine;hydrochloride |
| PubChem CID | 90486278 |
| Molecular Formula | C8H15BrClN3 |
| Molecular Weight | 268.59 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propan-1-amine;hydrochloride |
| SMILES | Cc1nn(CCCN)c(C)c1Br.Cl |
| InChI | InChI=1S/C8H14BrN3.ClH/c1-6-8(9)7(2)12(11-6)5-3-4-10;/h3-5,10H2,1-2H3;1H |
| InChIKey | AUFSCZQFGKFCME-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.59 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propan-1-amine;hydrochloride?
The IUPAC name of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propan-1-amine;hydrochloride (CID 90486278) is 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propan-1-amine;hydrochloride.
What is the SMILES notation for 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propan-1-amine;hydrochloride?
The canonical SMILES for 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propan-1-amine;hydrochloride is Cc1nn(CCCN)c(C)c1Br.Cl.
What is the InChIKey of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propan-1-amine;hydrochloride?
The InChIKey is AUFSCZQFGKFCME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14BrN3.ClH/c1-6-8(9)7(2)12(11-6)5-3-4-10;/h3-5,10H2,1-2H3;1H.
What are the key properties of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propan-1-amine;hydrochloride?
3-(4-bromo-3,5-dimethylpyrazol-1-yl)propan-1-amine;hydrochloride has a molecular weight of 268.59 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propan-1-amine;hydrochloride is sourced from PubChem (CID 90486278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).