About sodium 5-methyl-5-[(1R)-4-methylcyclohex-3-en-1-yl]-4H-1,2-oxazole-3-carboxylate
sodium 5-methyl-5-[(1R)-4-methylcyclohex-3-en-1-yl]-4H-1,2-oxazole-3-carboxylate (PubChem CID 90486303) has the molecular formula C12H16NNaO3
and a molecular weight of 245.25 g/mol. Its IUPAC name is sodium 5-methyl-5-[(1R)-4-methylcyclohex-3-en-1-yl]-4H-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | sodium 5-methyl-5-[(1R)-4-methylcyclohex-3-en-1-yl]-4H-1,2-oxazole-3-carboxylate |
| PubChem CID | 90486303 |
| Molecular Formula | C12H16NNaO3 |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | sodium 5-methyl-5-[(1R)-4-methylcyclohex-3-en-1-yl]-4H-1,2-oxazole-3-carboxylate |
| SMILES | CC1=CC[C@H](C2(C)CC(C(=O)[O-])=NO2)CC1.[Na+] |
| InChI | InChI=1S/C12H17NO3.Na/c1-8-3-5-9(6-4-8)12(2)7-10(11(14)15)13-16-12;/h3,9H,4-7H2,1-2H3,(H,14,15);/q;+1/p-1/t9-,12?;/m0./s1 |
| InChIKey | JAASGLWDXJDOEG-JDDMYJKFSA-M |
| XLogP | -1.98 |
| TPSA | 61.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze sodium 5-methyl-5-[(1R)-4-methylcyclohex-3-en-1-yl]-4H-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 5-methyl-5-[(1R)-4-methylcyclohex-3-en-1-yl]-4H-1,2-oxazole-3-carboxylate?
The IUPAC name of sodium 5-methyl-5-[(1R)-4-methylcyclohex-3-en-1-yl]-4H-1,2-oxazole-3-carboxylate (CID 90486303) is sodium 5-methyl-5-[(1R)-4-methylcyclohex-3-en-1-yl]-4H-1,2-oxazole-3-carboxylate.
What is the SMILES notation for sodium 5-methyl-5-[(1R)-4-methylcyclohex-3-en-1-yl]-4H-1,2-oxazole-3-carboxylate?
The canonical SMILES for sodium 5-methyl-5-[(1R)-4-methylcyclohex-3-en-1-yl]-4H-1,2-oxazole-3-carboxylate is CC1=CC[C@H](C2(C)CC(C(=O)[O-])=NO2)CC1.[Na+].
What is the InChIKey of sodium 5-methyl-5-[(1R)-4-methylcyclohex-3-en-1-yl]-4H-1,2-oxazole-3-carboxylate?
The InChIKey is JAASGLWDXJDOEG-JDDMYJKFSA-M. The full InChI is InChI=1S/C12H17NO3.Na/c1-8-3-5-9(6-4-8)12(2)7-10(11(14)15)13-16-12;/h3,9H,4-7H2,1-2H3,(H,14,15);/q;+1/p-1/t9-,12?;/m0./s1.
What are the key properties of sodium 5-methyl-5-[(1R)-4-methylcyclohex-3-en-1-yl]-4H-1,2-oxazole-3-carboxylate?
sodium 5-methyl-5-[(1R)-4-methylcyclohex-3-en-1-yl]-4H-1,2-oxazole-3-carboxylate has a molecular weight of 245.25 g/mol, XLogP of -1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5-methyl-5-[(1R)-4-methylcyclohex-3-en-1-yl]-4H-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 90486303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).