C14H23N3O7 — CID 90486342
1-[4-(2-hydroxyethylamino)butyl]-3,6-dimethylpyrimidine-2,4-dione;oxalic acid (PubChem CID 90486342) has the molecular formula C14H23N3O7 and a molecular weight of 345.35 g/mol. Its IUPAC name is 1-[4-(2-hydroxyethylamino)butyl]-3,6-dimethylpyrimidine-2,4-dione;oxalic acid.
| Compound Name | 1-[4-(2-hydroxyethylamino)butyl]-3,6-dimethylpyrimidine-2,4-dione;oxalic acid |
|---|---|
| PubChem CID | 90486342 |
| Molecular Formula | C14H23N3O7 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 1-[4-(2-hydroxyethylamino)butyl]-3,6-dimethylpyrimidine-2,4-dione;oxalic acid |
| SMILES | Cc1cc(=O)n(C)c(=O)n1CCCCNCCO.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H21N3O3.C2H2O4/c1-10-9-11(17)14(2)12(18)15(10)7-4-3-5-13-6-8-16;3-1(4)2(5)6/h9,13,16H,3-8H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | AMBLMKLZLHFZHO-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|