About 2-[(3-bromophenyl)methoxy]-1,3-di(propan-2-yl)benzene
2-[(3-bromophenyl)methoxy]-1,3-di(propan-2-yl)benzene (PubChem CID 90486421) has the molecular formula C19H23BrO
and a molecular weight of 347.30 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methoxy]-1,3-di(propan-2-yl)benzene.
Molecular Properties
| Compound Name | 2-[(3-bromophenyl)methoxy]-1,3-di(propan-2-yl)benzene |
| PubChem CID | 90486421 |
| Molecular Formula | C19H23BrO |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2-[(3-bromophenyl)methoxy]-1,3-di(propan-2-yl)benzene |
| SMILES | CC(C)c1cccc(C(C)C)c1OCc1cccc(Br)c1 |
| InChI | InChI=1S/C19H23BrO/c1-13(2)17-9-6-10-18(14(3)4)19(17)21-12-15-7-5-8-16(20)11-15/h5-11,13-14H,12H2,1-4H3 |
| InChIKey | PUEUTEXVWCKLIM-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(3-bromophenyl)methoxy]-1,3-di(propan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-bromophenyl)methoxy]-1,3-di(propan-2-yl)benzene?
The IUPAC name of 2-[(3-bromophenyl)methoxy]-1,3-di(propan-2-yl)benzene (CID 90486421) is 2-[(3-bromophenyl)methoxy]-1,3-di(propan-2-yl)benzene.
What is the SMILES notation for 2-[(3-bromophenyl)methoxy]-1,3-di(propan-2-yl)benzene?
The canonical SMILES for 2-[(3-bromophenyl)methoxy]-1,3-di(propan-2-yl)benzene is CC(C)c1cccc(C(C)C)c1OCc1cccc(Br)c1.
What is the InChIKey of 2-[(3-bromophenyl)methoxy]-1,3-di(propan-2-yl)benzene?
The InChIKey is PUEUTEXVWCKLIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23BrO/c1-13(2)17-9-6-10-18(14(3)4)19(17)21-12-15-7-5-8-16(20)11-15/h5-11,13-14H,12H2,1-4H3.
What are the key properties of 2-[(3-bromophenyl)methoxy]-1,3-di(propan-2-yl)benzene?
2-[(3-bromophenyl)methoxy]-1,3-di(propan-2-yl)benzene has a molecular weight of 347.30 g/mol, XLogP of 6.27, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-bromophenyl)methoxy]-1,3-di(propan-2-yl)benzene is sourced from PubChem (CID 90486421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).