C35H32N4O8S — CID 90486550
N,N-dimethylformamide;prop-2-enyl (2Z)-2-(1-ethyl-2-oxoindol-3-ylidene)-5-[4-(furan-2-carbonyloxy)phenyl]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 90486550) has the molecular formula C35H32N4O8S and a molecular weight of 668.73 g/mol. Its IUPAC name is N,N-dimethylformamide;prop-2-enyl (2Z)-2-(1-ethyl-2-oxoindol-3-ylidene)-5-[4-(furan-2-carbonyloxy)phenyl]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | N,N-dimethylformamide;prop-2-enyl (2Z)-2-(1-ethyl-2-oxoindol-3-ylidene)-5-[4-(furan-2-carbonyloxy)phenyl]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 90486550 |
| Molecular Formula | C35H32N4O8S |
| Molecular Weight | 668.73 g/mol |
| Exact Mass | 668.19 |
| IUPAC Name | N,N-dimethylformamide;prop-2-enyl (2Z)-2-(1-ethyl-2-oxoindol-3-ylidene)-5-[4-(furan-2-carbonyloxy)phenyl]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)N=c2s/c(=C3\C(=O)N(CC)c4ccccc43)c(=O)n2C1c1ccc(OC(=O)c2ccco2)cc1.CN(C)C=O |
| InChI | InChI=1S/C32H25N3O7S.C3H7NO/c1-4-16-41-31(39)24-18(3)33-32-35(26(24)19-12-14-20(15-13-19)42-30(38)23-11-8-17-40-23)29(37)27(43-32)25-21-9-6-7-10-22(21)34(5-2)28(25)36;1-4(2)3-5/h4,6-15,17,26H,1,5,16H2,2-3H3;3H,1-2H3/b27-25-; |
| InChIKey | YWYKFCUESFBJBK-WZRSSYQVSA-N |
| XLogP | 3.22 |
| TPSA | 140.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.73 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|