C44H42N8 — CID 90486736
2,4,6-triphenyl-3-[4-(2,4,6-triphenyl-1,3-dihydro-1,2,4,5-tetrazin-3-yl)butyl]-1,3-dihydro-1,2,4,5-tetrazine (PubChem CID 90486736) has the molecular formula C44H42N8 and a molecular weight of 682.88 g/mol. Its IUPAC name is 2,4,6-triphenyl-3-[4-(2,4,6-triphenyl-1,3-dihydro-1,2,4,5-tetrazin-3-yl)butyl]-1,3-dihydro-1,2,4,5-tetrazine.
| Compound Name | 2,4,6-triphenyl-3-[4-(2,4,6-triphenyl-1,3-dihydro-1,2,4,5-tetrazin-3-yl)butyl]-1,3-dihydro-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 90486736 |
| Molecular Formula | C44H42N8 |
| Molecular Weight | 682.88 g/mol |
| Exact Mass | 682.35 |
| IUPAC Name | 2,4,6-triphenyl-3-[4-(2,4,6-triphenyl-1,3-dihydro-1,2,4,5-tetrazin-3-yl)butyl]-1,3-dihydro-1,2,4,5-tetrazine |
| SMILES | c1ccc(C2=NN(c3ccccc3)C(CCCCC3N(c4ccccc4)N=C(c4ccccc4)NN3c3ccccc3)N(c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C44H42N8/c1-7-21-35(22-8-1)43-45-49(37-25-11-3-12-26-37)41(50(46-43)38-27-13-4-14-28-38)33-19-20-34-42-51(39-29-15-5-16-30-39)47-44(36-23-9-2-10-24-36)48-52(42)40-31-17-6-18-32-40/h1-18,21-32,41-42H,19-20,33-34H2,(H,45,46)(H,47,48) |
| InChIKey | DIWSEKOCJGAXIV-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 61.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.88 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|