About 4-methylaniline;(E)-2-(4-methylphenyl)-1-phenylethenesulfonic acid
4-methylaniline;(E)-2-(4-methylphenyl)-1-phenylethenesulfonic acid (PubChem CID 90486972) has the molecular formula C22H23NO3S
and a molecular weight of 381.50 g/mol. Its IUPAC name is 4-methylaniline;(E)-2-(4-methylphenyl)-1-phenylethenesulfonic acid.
Molecular Properties
| Compound Name | 4-methylaniline;(E)-2-(4-methylphenyl)-1-phenylethenesulfonic acid |
| PubChem CID | 90486972 |
| Molecular Formula | C22H23NO3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 4-methylaniline;(E)-2-(4-methylphenyl)-1-phenylethenesulfonic acid |
| SMILES | Cc1ccc(/C=C(\c2ccccc2)S(=O)(=O)O)cc1.Cc1ccc(N)cc1 |
| InChI | InChI=1S/C15H14O3S.C7H9N/c1-12-7-9-13(10-8-12)11-15(19(16,17)18)14-5-3-2-4-6-14;1-6-2-4-7(8)5-3-6/h2-11H,1H3,(H,16,17,18);2-5H,8H2,1H3/b15-11+; |
| InChIKey | HZYLHGZHVRBFAR-KRWCAOSLSA-N |
| XLogP | 4.96 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylaniline;(E)-2-(4-methylphenyl)-1-phenylethenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylaniline;(E)-2-(4-methylphenyl)-1-phenylethenesulfonic acid?
The IUPAC name of 4-methylaniline;(E)-2-(4-methylphenyl)-1-phenylethenesulfonic acid (CID 90486972) is 4-methylaniline;(E)-2-(4-methylphenyl)-1-phenylethenesulfonic acid.
What is the SMILES notation for 4-methylaniline;(E)-2-(4-methylphenyl)-1-phenylethenesulfonic acid?
The canonical SMILES for 4-methylaniline;(E)-2-(4-methylphenyl)-1-phenylethenesulfonic acid is Cc1ccc(/C=C(\c2ccccc2)S(=O)(=O)O)cc1.Cc1ccc(N)cc1.
What is the InChIKey of 4-methylaniline;(E)-2-(4-methylphenyl)-1-phenylethenesulfonic acid?
The InChIKey is HZYLHGZHVRBFAR-KRWCAOSLSA-N. The full InChI is InChI=1S/C15H14O3S.C7H9N/c1-12-7-9-13(10-8-12)11-15(19(16,17)18)14-5-3-2-4-6-14;1-6-2-4-7(8)5-3-6/h2-11H,1H3,(H,16,17,18);2-5H,8H2,1H3/b15-11+;.
What are the key properties of 4-methylaniline;(E)-2-(4-methylphenyl)-1-phenylethenesulfonic acid?
4-methylaniline;(E)-2-(4-methylphenyl)-1-phenylethenesulfonic acid has a molecular weight of 381.50 g/mol, XLogP of 4.96, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylaniline;(E)-2-(4-methylphenyl)-1-phenylethenesulfonic acid is sourced from PubChem (CID 90486972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).