C17H14Cl4O3 — CID 90487155
3,4,5,6-tetrachloro-16,16-dimethoxy-15-oxapentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-4,9,11,13-tetraene (PubChem CID 90487155) has the molecular formula C17H14Cl4O3 and a molecular weight of 408.11 g/mol. Its IUPAC name is 3,4,5,6-tetrachloro-16,16-dimethoxy-15-oxapentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-4,9,11,13-tetraene.
| Compound Name | 3,4,5,6-tetrachloro-16,16-dimethoxy-15-oxapentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-4,9,11,13-tetraene |
|---|---|
| PubChem CID | 90487155 |
| Molecular Formula | C17H14Cl4O3 |
| Molecular Weight | 408.11 g/mol |
| Exact Mass | 405.97 |
| IUPAC Name | 3,4,5,6-tetrachloro-16,16-dimethoxy-15-oxapentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-4,9,11,13-tetraene |
| SMILES | COC1(OC)C2(Cl)C(Cl)=C(Cl)C1(Cl)C1C3OC(c4ccccc43)C12 |
| InChI | InChI=1S/C17H14Cl4O3/c1-22-17(23-2)15(20)9-10(16(17,21)14(19)13(15)18)12-8-6-4-3-5-7(8)11(9)24-12/h3-6,9-12H,1-2H3 |
| InChIKey | QYDMDDZUYMHXQJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.11 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|