C29H23N3O2 — CID 90487274
4-methyl-10-(1,2,3-triphenylcycloprop-2-en-1-yl)-2,4,6-triazatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 90487274) has the molecular formula C29H23N3O2 and a molecular weight of 445.52 g/mol. Its IUPAC name is 4-methyl-10-(1,2,3-triphenylcycloprop-2-en-1-yl)-2,4,6-triazatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-methyl-10-(1,2,3-triphenylcycloprop-2-en-1-yl)-2,4,6-triazatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 90487274 |
| Molecular Formula | C29H23N3O2 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 4-methyl-10-(1,2,3-triphenylcycloprop-2-en-1-yl)-2,4,6-triazatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | Cn1c(=O)n2n(c1=O)C1C=CC2C1C1(c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C29H23N3O2/c1-30-27(33)31-22-17-18-23(32(31)28(30)34)26(22)29(21-15-9-4-10-16-21)24(19-11-5-2-6-12-19)25(29)20-13-7-3-8-14-20/h2-18,22-23,26H,1H3 |
| InChIKey | HJXOYPOZEUPAFB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|