C13H21Si+ — CID 90487411
4,4a,5,6,7,8-hexahydronaphthalen-4-ylium-2-yl(trimethyl)silane (PubChem CID 90487411) has the molecular formula C13H21Si+ and a molecular weight of 205.40 g/mol. Its IUPAC name is 4,4a,5,6,7,8-hexahydronaphthalen-4-ylium-2-yl(trimethyl)silane.
| Compound Name | 4,4a,5,6,7,8-hexahydronaphthalen-4-ylium-2-yl(trimethyl)silane |
|---|---|
| PubChem CID | 90487411 |
| Molecular Formula | C13H21Si+ |
| Molecular Weight | 205.40 g/mol |
| Exact Mass | 205.14 |
| IUPAC Name | 4,4a,5,6,7,8-hexahydronaphthalen-4-ylium-2-yl(trimethyl)silane |
| SMILES | C[Si](C)(C)C1=C[CH+]C2CCCCC2=C1 |
| InChI | InChI=1S/C13H21Si/c1-14(2,3)13-9-8-11-6-4-5-7-12(11)10-13/h8-11H,4-7H2,1-3H3/q+1 |
| InChIKey | YVKHJDAYPPMGBC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|