About 8,8-dideuteriotricyclo[5.2.1.04,10]deca-2,5-diene
8,8-dideuteriotricyclo[5.2.1.04,10]deca-2,5-diene (PubChem CID 90487416) has the molecular formula C10H12
and a molecular weight of 134.22 g/mol. Its IUPAC name is 8,8-dideuteriotricyclo[5.2.1.04,10]deca-2,5-diene.
Molecular Properties
| Compound Name | 8,8-dideuteriotricyclo[5.2.1.04,10]deca-2,5-diene |
| PubChem CID | 90487416 |
| Molecular Formula | C10H12 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | 8,8-dideuteriotricyclo[5.2.1.04,10]deca-2,5-diene |
| SMILES | [2H]C1([2H])CC2C=CC3C=CC1C32 |
| InChI | InChI=1S/C10H12/c1-2-8-5-6-9-4-3-7(1)10(8)9/h1-4,7-10H,5-6H2/i5D2 |
| InChIKey | WFYJSBGFDIPAEJ-BFWBPSQCSA-N |
| XLogP | 2.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8,8-dideuteriotricyclo[5.2.1.04,10]deca-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-dideuteriotricyclo[5.2.1.04,10]deca-2,5-diene?
The IUPAC name of 8,8-dideuteriotricyclo[5.2.1.04,10]deca-2,5-diene (CID 90487416) is 8,8-dideuteriotricyclo[5.2.1.04,10]deca-2,5-diene.
What is the SMILES notation for 8,8-dideuteriotricyclo[5.2.1.04,10]deca-2,5-diene?
The canonical SMILES for 8,8-dideuteriotricyclo[5.2.1.04,10]deca-2,5-diene is [2H]C1([2H])CC2C=CC3C=CC1C32.
What is the InChIKey of 8,8-dideuteriotricyclo[5.2.1.04,10]deca-2,5-diene?
The InChIKey is WFYJSBGFDIPAEJ-BFWBPSQCSA-N. The full InChI is InChI=1S/C10H12/c1-2-8-5-6-9-4-3-7(1)10(8)9/h1-4,7-10H,5-6H2/i5D2.
What are the key properties of 8,8-dideuteriotricyclo[5.2.1.04,10]deca-2,5-diene?
8,8-dideuteriotricyclo[5.2.1.04,10]deca-2,5-diene has a molecular weight of 134.22 g/mol, XLogP of 2.38, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-dideuteriotricyclo[5.2.1.04,10]deca-2,5-diene is sourced from PubChem (CID 90487416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).