About 6-bromo-1,3-dichloronaphthalene
6-bromo-1,3-dichloronaphthalene (PubChem CID 90487701) has the molecular formula C10H5BrCl2
and a molecular weight of 275.96 g/mol. Its IUPAC name is 6-bromo-1,3-dichloronaphthalene.
Molecular Properties
| Compound Name | 6-bromo-1,3-dichloronaphthalene |
| PubChem CID | 90487701 |
| Molecular Formula | C10H5BrCl2 |
| Molecular Weight | 275.96 g/mol |
| Exact Mass | 273.90 |
| IUPAC Name | 6-bromo-1,3-dichloronaphthalene |
| SMILES | Clc1cc(Cl)c2ccc(Br)cc2c1 |
| InChI | InChI=1S/C10H5BrCl2/c11-7-1-2-9-6(3-7)4-8(12)5-10(9)13/h1-5H |
| InChIKey | JLMKWZBGKJHAGT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.96 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-bromo-1,3-dichloronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1,3-dichloronaphthalene?
The IUPAC name of 6-bromo-1,3-dichloronaphthalene (CID 90487701) is 6-bromo-1,3-dichloronaphthalene.
What is the SMILES notation for 6-bromo-1,3-dichloronaphthalene?
The canonical SMILES for 6-bromo-1,3-dichloronaphthalene is Clc1cc(Cl)c2ccc(Br)cc2c1.
What is the InChIKey of 6-bromo-1,3-dichloronaphthalene?
The InChIKey is JLMKWZBGKJHAGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5BrCl2/c11-7-1-2-9-6(3-7)4-8(12)5-10(9)13/h1-5H.
What are the key properties of 6-bromo-1,3-dichloronaphthalene?
6-bromo-1,3-dichloronaphthalene has a molecular weight of 275.96 g/mol, XLogP of 4.91, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1,3-dichloronaphthalene is sourced from PubChem (CID 90487701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).