About 3-(4-bromophenyl)furan
3-(4-bromophenyl)furan (PubChem CID 90487852) has the molecular formula C10H7BrO
and a molecular weight of 223.07 g/mol. Its IUPAC name is 3-(4-bromophenyl)furan.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)furan |
| PubChem CID | 90487852 |
| Molecular Formula | C10H7BrO |
| Molecular Weight | 223.07 g/mol |
| Exact Mass | 221.97 |
| IUPAC Name | 3-(4-bromophenyl)furan |
| SMILES | Brc1ccc(-c2ccoc2)cc1 |
| InChI | InChI=1S/C10H7BrO/c11-10-3-1-8(2-4-10)9-5-6-12-7-9/h1-7H |
| InChIKey | SDKJDQLEFMMXET-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.07 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(4-bromophenyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)furan?
The IUPAC name of 3-(4-bromophenyl)furan (CID 90487852) is 3-(4-bromophenyl)furan.
What is the SMILES notation for 3-(4-bromophenyl)furan?
The canonical SMILES for 3-(4-bromophenyl)furan is Brc1ccc(-c2ccoc2)cc1.
What is the InChIKey of 3-(4-bromophenyl)furan?
The InChIKey is SDKJDQLEFMMXET-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrO/c11-10-3-1-8(2-4-10)9-5-6-12-7-9/h1-7H.
What are the key properties of 3-(4-bromophenyl)furan?
3-(4-bromophenyl)furan has a molecular weight of 223.07 g/mol, XLogP of 3.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)furan is sourced from PubChem (CID 90487852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).