About (2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-4-yl)methanol
(2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-4-yl)methanol (PubChem CID 90488145) has the molecular formula C13H20N4O
and a molecular weight of 248.33 g/mol. Its IUPAC name is (2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-4-yl)methanol.
Molecular Properties
| Compound Name | (2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-4-yl)methanol |
| PubChem CID | 90488145 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | (2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-4-yl)methanol |
| SMILES | OCC1CN(c2ncccn2)CC12CCNCC2 |
| InChI | InChI=1S/C13H20N4O/c18-9-11-8-17(12-15-4-1-5-16-12)10-13(11)2-6-14-7-3-13/h1,4-5,11,14,18H,2-3,6-10H2 |
| InChIKey | KEQKAVGYDBSSFO-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-4-yl)methanol?
The IUPAC name of (2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-4-yl)methanol (CID 90488145) is (2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-4-yl)methanol.
What is the SMILES notation for (2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-4-yl)methanol?
The canonical SMILES for (2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-4-yl)methanol is OCC1CN(c2ncccn2)CC12CCNCC2.
What is the InChIKey of (2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-4-yl)methanol?
The InChIKey is KEQKAVGYDBSSFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O/c18-9-11-8-17(12-15-4-1-5-16-12)10-13(11)2-6-14-7-3-13/h1,4-5,11,14,18H,2-3,6-10H2.
What are the key properties of (2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-4-yl)methanol?
(2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-4-yl)methanol has a molecular weight of 248.33 g/mol, XLogP of 0.27, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-4-yl)methanol is sourced from PubChem (CID 90488145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).