About (5-methylsulfanyl-1,3-oxazol-4-yl)-triphenylphosphanium iodide
(5-methylsulfanyl-1,3-oxazol-4-yl)-triphenylphosphanium iodide (PubChem CID 90489740) has the molecular formula C22H19INOPS
and a molecular weight of 503.35 g/mol. Its IUPAC name is (5-methylsulfanyl-1,3-oxazol-4-yl)-triphenylphosphanium iodide.
Molecular Properties
| Compound Name | (5-methylsulfanyl-1,3-oxazol-4-yl)-triphenylphosphanium iodide |
| PubChem CID | 90489740 |
| Molecular Formula | C22H19INOPS |
| Molecular Weight | 503.35 g/mol |
| Exact Mass | 503.00 |
| IUPAC Name | (5-methylsulfanyl-1,3-oxazol-4-yl)-triphenylphosphanium iodide |
| SMILES | CSc1ocnc1[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-] |
| InChI | InChI=1S/C22H19NOPS.HI/c1-26-22-21(23-17-24-22)25(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;/h2-17H,1H3;1H/q+1;/p-1 |
| InChIKey | ROIZRWQYYDMWKR-UHFFFAOYSA-M |
| XLogP | 1.02 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 503.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (5-methylsulfanyl-1,3-oxazol-4-yl)-triphenylphosphanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methylsulfanyl-1,3-oxazol-4-yl)-triphenylphosphanium iodide?
The IUPAC name of (5-methylsulfanyl-1,3-oxazol-4-yl)-triphenylphosphanium iodide (CID 90489740) is (5-methylsulfanyl-1,3-oxazol-4-yl)-triphenylphosphanium iodide.
What is the SMILES notation for (5-methylsulfanyl-1,3-oxazol-4-yl)-triphenylphosphanium iodide?
The canonical SMILES for (5-methylsulfanyl-1,3-oxazol-4-yl)-triphenylphosphanium iodide is CSc1ocnc1[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-].
What is the InChIKey of (5-methylsulfanyl-1,3-oxazol-4-yl)-triphenylphosphanium iodide?
The InChIKey is ROIZRWQYYDMWKR-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H19NOPS.HI/c1-26-22-21(23-17-24-22)25(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;/h2-17H,1H3;1H/q+1;/p-1.
What are the key properties of (5-methylsulfanyl-1,3-oxazol-4-yl)-triphenylphosphanium iodide?
(5-methylsulfanyl-1,3-oxazol-4-yl)-triphenylphosphanium iodide has a molecular weight of 503.35 g/mol, XLogP of 1.02, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methylsulfanyl-1,3-oxazol-4-yl)-triphenylphosphanium iodide is sourced from PubChem (CID 90489740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).