C19H23ClN4O2 — CID 90491961
3-chloro-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]benzamide (PubChem CID 90491961) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is 3-chloro-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]benzamide.
| Compound Name | 3-chloro-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]benzamide |
|---|---|
| PubChem CID | 90491961 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 3-chloro-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]benzamide |
| SMILES | Cc1nc(OCCNC(=O)c2cccc(Cl)c2)cc(N2CCCCC2)n1 |
| InChI | InChI=1S/C19H23ClN4O2/c1-14-22-17(24-9-3-2-4-10-24)13-18(23-14)26-11-8-21-19(25)15-6-5-7-16(20)12-15/h5-7,12-13H,2-4,8-11H2,1H3,(H,21,25) |
| InChIKey | PBBVNVJJPREHQP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|