C22H27N5O — CID 90493280
[4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]-(1-methyl-3-phenylpyrazol-5-yl)methanone (PubChem CID 90493280) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is [4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]-(1-methyl-3-phenylpyrazol-5-yl)methanone.
| Compound Name | [4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]-(1-methyl-3-phenylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 90493280 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | [4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]-(1-methyl-3-phenylpyrazol-5-yl)methanone |
| SMILES | CCc1nccn1CC1CCN(C(=O)c2cc(-c3ccccc3)nn2C)CC1 |
| InChI | InChI=1S/C22H27N5O/c1-3-21-23-11-14-27(21)16-17-9-12-26(13-10-17)22(28)20-15-19(24-25(20)2)18-7-5-4-6-8-18/h4-8,11,14-15,17H,3,9-10,12-13,16H2,1-2H3 |
| InChIKey | NEMCFRRRQPVFOF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |