C19H23ClFN3O — CID 90493335
2-(2-chloro-6-fluorophenyl)-1-[4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]ethanone (PubChem CID 90493335) has the molecular formula C19H23ClFN3O and a molecular weight of 363.86 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 90493335 |
| Molecular Formula | C19H23ClFN3O |
| Molecular Weight | 363.86 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]ethanone |
| SMILES | CCc1nccn1CC1CCN(C(=O)Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C19H23ClFN3O/c1-2-18-22-8-11-24(18)13-14-6-9-23(10-7-14)19(25)12-15-16(20)4-3-5-17(15)21/h3-5,8,11,14H,2,6-7,9-10,12-13H2,1H3 |
| InChIKey | QFFIBUSJXGDKKL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.86 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |