C20H27ClN4O — CID 90493968
N-(3-chloro-4-methylphenyl)-2-[4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]acetamide (PubChem CID 90493968) has the molecular formula C20H27ClN4O and a molecular weight of 374.92 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 90493968 |
| Molecular Formula | C20H27ClN4O |
| Molecular Weight | 374.92 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]acetamide |
| SMILES | CCc1nccn1CC1CCN(CC(=O)Nc2ccc(C)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H27ClN4O/c1-3-19-22-8-11-25(19)13-16-6-9-24(10-7-16)14-20(26)23-17-5-4-15(2)18(21)12-17/h4-5,8,11-12,16H,3,6-7,9-10,13-14H2,1-2H3,(H,23,26) |
| InChIKey | PYUWFARKPFHSAY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.92 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |