C16H26N4O — CID 90495494
2-[4-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]-N-prop-2-enylacetamide (PubChem CID 90495494) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-[4-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[4-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 90495494 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 2-[4-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN1CCC(Cn2nc(C)cc2C)CC1 |
| InChI | InChI=1S/C16H26N4O/c1-4-7-17-16(21)12-19-8-5-15(6-9-19)11-20-14(3)10-13(2)18-20/h4,10,15H,1,5-9,11-12H2,2-3H3,(H,17,21) |
| InChIKey | IPYBEQOKWIRKAT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|