C19H18FNO2S — CID 90495634
2-(4-fluorophenyl)-N-(furan-2-ylmethyl)-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 90495634) has the molecular formula C19H18FNO2S and a molecular weight of 343.42 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(furan-2-ylmethyl)-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-(furan-2-ylmethyl)-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 90495634 |
| Molecular Formula | C19H18FNO2S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(furan-2-ylmethyl)-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)N(CCc1cccs1)Cc1ccco1 |
| InChI | InChI=1S/C19H18FNO2S/c20-16-7-5-15(6-8-16)13-19(22)21(14-17-3-1-11-23-17)10-9-18-4-2-12-24-18/h1-8,11-12H,9-10,13-14H2 |
| InChIKey | WKYJHHOQGYUBPG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |