C16H20N2O3 — CID 90496212
4-ethoxy-N-[2-hydroxy-2-(1-methylpyrrol-2-yl)ethyl]benzamide (PubChem CID 90496212) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-ethoxy-N-[2-hydroxy-2-(1-methylpyrrol-2-yl)ethyl]benzamide.
| Compound Name | 4-ethoxy-N-[2-hydroxy-2-(1-methylpyrrol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 90496212 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4-ethoxy-N-[2-hydroxy-2-(1-methylpyrrol-2-yl)ethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCC(O)c2cccn2C)cc1 |
| InChI | InChI=1S/C16H20N2O3/c1-3-21-13-8-6-12(7-9-13)16(20)17-11-15(19)14-5-4-10-18(14)2/h4-10,15,19H,3,11H2,1-2H3,(H,17,20) |
| InChIKey | FUQZUAAKQQWCMM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |