C23H20N2O2S — CID 90497526
N-[2-hydroxy-2-(4-phenylphenyl)propyl]-1,3-benzothiazole-2-carboxamide (PubChem CID 90497526) has the molecular formula C23H20N2O2S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-[2-hydroxy-2-(4-phenylphenyl)propyl]-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-[2-hydroxy-2-(4-phenylphenyl)propyl]-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 90497526 |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[2-hydroxy-2-(4-phenylphenyl)propyl]-1,3-benzothiazole-2-carboxamide |
| SMILES | CC(O)(CNC(=O)c1nc2ccccc2s1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N2O2S/c1-23(27,18-13-11-17(12-14-18)16-7-3-2-4-8-16)15-24-21(26)22-25-19-9-5-6-10-20(19)28-22/h2-14,27H,15H2,1H3,(H,24,26) |
| InChIKey | YNMZIIPBPLQQML-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |