C18H16F3N3O5 — CID 90498142
N'-(2-methyl-5-nitrophenyl)-N-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)oxamide (PubChem CID 90498142) has the molecular formula C18H16F3N3O5 and a molecular weight of 411.34 g/mol. Its IUPAC name is N'-(2-methyl-5-nitrophenyl)-N-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)oxamide.
| Compound Name | N'-(2-methyl-5-nitrophenyl)-N-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)oxamide |
|---|---|
| PubChem CID | 90498142 |
| Molecular Formula | C18H16F3N3O5 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | N'-(2-methyl-5-nitrophenyl)-N-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)oxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)NCC(O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H16F3N3O5/c1-11-7-8-13(24(28)29)9-14(11)23-16(26)15(25)22-10-17(27,18(19,20)21)12-5-3-2-4-6-12/h2-9,27H,10H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | QXLYGWUITIIHFT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|