C19H29NO4 — CID 90498823
N-(2-cyclohexyl-2-hydroxyethyl)-3,4-diethoxybenzamide (PubChem CID 90498823) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is N-(2-cyclohexyl-2-hydroxyethyl)-3,4-diethoxybenzamide.
| Compound Name | N-(2-cyclohexyl-2-hydroxyethyl)-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 90498823 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | N-(2-cyclohexyl-2-hydroxyethyl)-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCC(O)C2CCCCC2)cc1OCC |
| InChI | InChI=1S/C19H29NO4/c1-3-23-17-11-10-15(12-18(17)24-4-2)19(22)20-13-16(21)14-8-6-5-7-9-14/h10-12,14,16,21H,3-9,13H2,1-2H3,(H,20,22) |
| InChIKey | QHLCUDBPBGRTCR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |