C15H20INO2 — CID 90498837
N-(2-cyclohexyl-2-hydroxyethyl)-2-iodobenzamide (PubChem CID 90498837) has the molecular formula C15H20INO2 and a molecular weight of 373.23 g/mol. Its IUPAC name is N-(2-cyclohexyl-2-hydroxyethyl)-2-iodobenzamide.
| Compound Name | N-(2-cyclohexyl-2-hydroxyethyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 90498837 |
| Molecular Formula | C15H20INO2 |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | N-(2-cyclohexyl-2-hydroxyethyl)-2-iodobenzamide |
| SMILES | O=C(NCC(O)C1CCCCC1)c1ccccc1I |
| InChI | InChI=1S/C15H20INO2/c16-13-9-5-4-8-12(13)15(19)17-10-14(18)11-6-2-1-3-7-11/h4-5,8-9,11,14,18H,1-3,6-7,10H2,(H,17,19) |
| InChIKey | VAPGDKJJVGIOPB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|