C15H15N3O4 — CID 90499157
N-[(1-hydroxy-2,3-dihydroinden-1-yl)methyl]-N'-(1,2-oxazol-3-yl)oxamide (PubChem CID 90499157) has the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. Its IUPAC name is N-[(1-hydroxy-2,3-dihydroinden-1-yl)methyl]-N'-(1,2-oxazol-3-yl)oxamide.
| Compound Name | N-[(1-hydroxy-2,3-dihydroinden-1-yl)methyl]-N'-(1,2-oxazol-3-yl)oxamide |
|---|---|
| PubChem CID | 90499157 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-[(1-hydroxy-2,3-dihydroinden-1-yl)methyl]-N'-(1,2-oxazol-3-yl)oxamide |
| SMILES | O=C(NCC1(O)CCc2ccccc21)C(=O)Nc1ccon1 |
| InChI | InChI=1S/C15H15N3O4/c19-13(14(20)17-12-6-8-22-18-12)16-9-15(21)7-5-10-3-1-2-4-11(10)15/h1-4,6,8,21H,5,7,9H2,(H,16,19)(H,17,18,20) |
| InChIKey | QGJJJEYPHRATDB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|