C17H15IN2O2 — CID 9050034
3-iodo-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzamide (PubChem CID 9050034) has the molecular formula C17H15IN2O2 and a molecular weight of 406.22 g/mol. Its IUPAC name is 3-iodo-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzamide.
| Compound Name | 3-iodo-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 9050034 |
| Molecular Formula | C17H15IN2O2 |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 3-iodo-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(N2CCCC2=O)c1)c1cccc(I)c1 |
| InChI | InChI=1S/C17H15IN2O2/c18-13-5-1-4-12(10-13)17(22)19-14-6-2-7-15(11-14)20-9-3-8-16(20)21/h1-2,4-7,10-11H,3,8-9H2,(H,19,22) |
| InChIKey | IGMUXPSHFMXJEP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|