C16H18N2O3 — CID 90500522
methyl 4-(3-pyrrol-1-ylpropylcarbamoyl)benzoate (PubChem CID 90500522) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is methyl 4-(3-pyrrol-1-ylpropylcarbamoyl)benzoate.
| Compound Name | methyl 4-(3-pyrrol-1-ylpropylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 90500522 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | methyl 4-(3-pyrrol-1-ylpropylcarbamoyl)benzoate |
| SMILES | COC(=O)c1ccc(C(=O)NCCCn2cccc2)cc1 |
| InChI | InChI=1S/C16H18N2O3/c1-21-16(20)14-7-5-13(6-8-14)15(19)17-9-4-12-18-10-2-3-11-18/h2-3,5-8,10-11H,4,9,12H2,1H3,(H,17,19) |
| InChIKey | BFFZIMRVLGWGJM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|