C20H21IN4O — CID 90501308
(2-tert-butyl-3-pyrrol-1-yl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-(2-iodophenyl)methanone (PubChem CID 90501308) has the molecular formula C20H21IN4O and a molecular weight of 460.32 g/mol. Its IUPAC name is (2-tert-butyl-3-pyrrol-1-yl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-(2-iodophenyl)methanone.
| Compound Name | (2-tert-butyl-3-pyrrol-1-yl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-(2-iodophenyl)methanone |
|---|---|
| PubChem CID | 90501308 |
| Molecular Formula | C20H21IN4O |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | (2-tert-butyl-3-pyrrol-1-yl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-(2-iodophenyl)methanone |
| SMILES | CC(C)(C)n1nc2c(c1-n1cccc1)CN(C(=O)c1ccccc1I)C2 |
| InChI | InChI=1S/C20H21IN4O/c1-20(2,3)25-18(23-10-6-7-11-23)15-12-24(13-17(15)22-25)19(26)14-8-4-5-9-16(14)21/h4-11H,12-13H2,1-3H3 |
| InChIKey | DMSKQBJYMGDTQR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|