C24H21N5O3 — CID 90501996
1-[2-(2-methylphenyl)-3-pyrrol-1-yl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-2-(4-nitrophenyl)ethanone (PubChem CID 90501996) has the molecular formula C24H21N5O3 and a molecular weight of 427.46 g/mol. Its IUPAC name is 1-[2-(2-methylphenyl)-3-pyrrol-1-yl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-2-(4-nitrophenyl)ethanone.
| Compound Name | 1-[2-(2-methylphenyl)-3-pyrrol-1-yl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-2-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 90501996 |
| Molecular Formula | C24H21N5O3 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 1-[2-(2-methylphenyl)-3-pyrrol-1-yl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-2-(4-nitrophenyl)ethanone |
| SMILES | Cc1ccccc1-n1nc2c(c1-n1cccc1)CN(C(=O)Cc1ccc([N+](=O)[O-])cc1)C2 |
| InChI | InChI=1S/C24H21N5O3/c1-17-6-2-3-7-22(17)28-24(26-12-4-5-13-26)20-15-27(16-21(20)25-28)23(30)14-18-8-10-19(11-9-18)29(31)32/h2-13H,14-16H2,1H3 |
| InChIKey | PIVXOCJMUPAWMM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|