C21H22N4O — CID 90502117
(E)-1-[2-(2,4-dimethylphenyl)-3-pyrrol-1-yl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]but-2-en-1-one (PubChem CID 90502117) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is (E)-1-[2-(2,4-dimethylphenyl)-3-pyrrol-1-yl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]but-2-en-1-one.
| Compound Name | (E)-1-[2-(2,4-dimethylphenyl)-3-pyrrol-1-yl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 90502117 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (E)-1-[2-(2,4-dimethylphenyl)-3-pyrrol-1-yl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]but-2-en-1-one |
| SMILES | C/C=C/C(=O)N1Cc2nn(-c3ccc(C)cc3C)c(-n3cccc3)c2C1 |
| InChI | InChI=1S/C21H22N4O/c1-4-7-20(26)24-13-17-18(14-24)22-25(21(17)23-10-5-6-11-23)19-9-8-15(2)12-16(19)3/h4-12H,13-14H2,1-3H3/b7-4+ |
| InChIKey | YFMHVTHBNYNRQB-QPJJXVBHSA-N |
| XLogP | 3.70 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|