C18H14F3N3O — CID 90505719
[3-(1H-benzimidazol-2-yl)azetidin-1-yl]-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 90505719) has the molecular formula C18H14F3N3O and a molecular weight of 345.32 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)azetidin-1-yl]-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | [3-(1H-benzimidazol-2-yl)azetidin-1-yl]-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 90505719 |
| Molecular Formula | C18H14F3N3O |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)azetidin-1-yl]-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccccc1C(F)(F)F)N1CC(c2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C18H14F3N3O/c19-18(20,21)13-6-2-1-5-12(13)17(25)24-9-11(10-24)16-22-14-7-3-4-8-15(14)23-16/h1-8,11H,9-10H2,(H,22,23) |
| InChIKey | YUTJJPFGNHGRMJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |