About N-(1-benzylpiperidin-4-yl)-2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxamide
N-(1-benzylpiperidin-4-yl)-2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxamide (PubChem CID 90506053) has the molecular formula C20H22N6OS
and a molecular weight of 394.50 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxamide |
| PubChem CID | 90506053 |
| Molecular Formula | C20H22N6OS |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)c1csc(Nc2ncccn2)n1 |
| InChI | InChI=1S/C20H22N6OS/c27-18(17-14-28-20(24-17)25-19-21-9-4-10-22-19)23-16-7-11-26(12-8-16)13-15-5-2-1-3-6-15/h1-6,9-10,14,16H,7-8,11-13H2,(H,23,27)(H,21,22,24,25) |
| InChIKey | GCQRARATXONXHA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(1-benzylpiperidin-4-yl)-2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-benzylpiperidin-4-yl)-2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxamide?
The IUPAC name of N-(1-benzylpiperidin-4-yl)-2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxamide (CID 90506053) is N-(1-benzylpiperidin-4-yl)-2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-(1-benzylpiperidin-4-yl)-2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-(1-benzylpiperidin-4-yl)-2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxamide is O=C(NC1CCN(Cc2ccccc2)CC1)c1csc(Nc2ncccn2)n1.
What is the InChIKey of N-(1-benzylpiperidin-4-yl)-2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxamide?
The InChIKey is GCQRARATXONXHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N6OS/c27-18(17-14-28-20(24-17)25-19-21-9-4-10-22-19)23-16-7-11-26(12-8-16)13-15-5-2-1-3-6-15/h1-6,9-10,14,16H,7-8,11-13H2,(H,23,27)(H,21,22,24,25).
What are the key properties of N-(1-benzylpiperidin-4-yl)-2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxamide?
N-(1-benzylpiperidin-4-yl)-2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxamide has a molecular weight of 394.50 g/mol, XLogP of 3.07, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-benzylpiperidin-4-yl)-2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 90506053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).