C21H22N3O4S+ — CID 9050636
[(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium (PubChem CID 9050636) has the molecular formula C21H22N3O4S+ and a molecular weight of 412.49 g/mol. Its IUPAC name is [(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium.
| Compound Name | [(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 9050636 |
| Molecular Formula | C21H22N3O4S+ |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H](C)[NH2+][C@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C21H21N3O4S/c1-14(21(25)23-17-13-16(24(26)27)10-11-18(17)28-2)22-20(19-9-6-12-29-19)15-7-4-3-5-8-15/h3-14,20,22H,1-2H3,(H,23,25)/p+1/t14-,20-/m1/s1 |
| InChIKey | RQJCWXLKZHULQQ-JLTOFOAXSA-O |
| XLogP | 3.34 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|