C18H27N5O2S — CID 90507644
1-butylsulfonyl-4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)piperazine (PubChem CID 90507644) has the molecular formula C18H27N5O2S and a molecular weight of 377.51 g/mol. Its IUPAC name is 1-butylsulfonyl-4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)piperazine.
| Compound Name | 1-butylsulfonyl-4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)piperazine |
|---|---|
| PubChem CID | 90507644 |
| Molecular Formula | C18H27N5O2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 1-butylsulfonyl-4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)piperazine |
| SMILES | CCCCS(=O)(=O)N1CCN(c2c(C)nn(-c3ccccn3)c2C)CC1 |
| InChI | InChI=1S/C18H27N5O2S/c1-4-5-14-26(24,25)22-12-10-21(11-13-22)18-15(2)20-23(16(18)3)17-8-6-7-9-19-17/h6-9H,4-5,10-14H2,1-3H3 |
| InChIKey | UAXREFYYPXGGIX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |