C24H30N6O — CID 90508127
4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)-N-(3-phenylpropyl)piperazine-1-carboxamide (PubChem CID 90508127) has the molecular formula C24H30N6O and a molecular weight of 418.55 g/mol. Its IUPAC name is 4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)-N-(3-phenylpropyl)piperazine-1-carboxamide.
| Compound Name | 4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)-N-(3-phenylpropyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 90508127 |
| Molecular Formula | C24H30N6O |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)-N-(3-phenylpropyl)piperazine-1-carboxamide |
| SMILES | Cc1nn(-c2ccccn2)c(C)c1N1CCN(C(=O)NCCCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N6O/c1-19-23(20(2)30(27-19)22-12-6-7-13-25-22)28-15-17-29(18-16-28)24(31)26-14-8-11-21-9-4-3-5-10-21/h3-7,9-10,12-13H,8,11,14-18H2,1-2H3,(H,26,31) |
| InChIKey | FYMXITKZCPMFFS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|