C18H29N5O3S — CID 90508242
2-[4-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]piperazin-1-yl]-N-prop-2-enylacetamide (PubChem CID 90508242) has the molecular formula C18H29N5O3S and a molecular weight of 395.53 g/mol. Its IUPAC name is 2-[4-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]piperazin-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[4-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]piperazin-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 90508242 |
| Molecular Formula | C18H29N5O3S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-[4-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]piperazin-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN1CCN(c2c(C)nn(C3CCS(=O)(=O)C3)c2C)CC1 |
| InChI | InChI=1S/C18H29N5O3S/c1-4-6-19-17(24)12-21-7-9-22(10-8-21)18-14(2)20-23(15(18)3)16-5-11-27(25,26)13-16/h4,16H,1,5-13H2,2-3H3,(H,19,24) |
| InChIKey | RQUVADZYEIDVOE-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|