About N-[2-(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)ethyl]-2-propylpentanamide
N-[2-(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)ethyl]-2-propylpentanamide (PubChem CID 90508343) has the molecular formula C17H25N3O2S
and a molecular weight of 335.47 g/mol. Its IUPAC name is N-[2-(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)ethyl]-2-propylpentanamide.
Molecular Properties
| Compound Name | N-[2-(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)ethyl]-2-propylpentanamide |
| PubChem CID | 90508343 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-[2-(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)ethyl]-2-propylpentanamide |
| SMILES | CCCC(CCC)C(=O)NCCc1csc2nc(C)cc(=O)n12 |
| InChI | InChI=1S/C17H25N3O2S/c1-4-6-13(7-5-2)16(22)18-9-8-14-11-23-17-19-12(3)10-15(21)20(14)17/h10-11,13H,4-9H2,1-3H3,(H,18,22) |
| InChIKey | IHNVDRTVUABKFO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)ethyl]-2-propylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)ethyl]-2-propylpentanamide?
The IUPAC name of N-[2-(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)ethyl]-2-propylpentanamide (CID 90508343) is N-[2-(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)ethyl]-2-propylpentanamide.
What is the SMILES notation for N-[2-(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)ethyl]-2-propylpentanamide?
The canonical SMILES for N-[2-(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)ethyl]-2-propylpentanamide is CCCC(CCC)C(=O)NCCc1csc2nc(C)cc(=O)n12.
What is the InChIKey of N-[2-(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)ethyl]-2-propylpentanamide?
The InChIKey is IHNVDRTVUABKFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3O2S/c1-4-6-13(7-5-2)16(22)18-9-8-14-11-23-17-19-12(3)10-15(21)20(14)17/h10-11,13H,4-9H2,1-3H3,(H,18,22).
What are the key properties of N-[2-(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)ethyl]-2-propylpentanamide?
N-[2-(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)ethyl]-2-propylpentanamide has a molecular weight of 335.47 g/mol, XLogP of 2.94, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)ethyl]-2-propylpentanamide is sourced from PubChem (CID 90508343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).