C20H15N3O6 — CID 90509059
3-[3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]azetidine-1-carbonyl]-8-methoxychromen-2-one (PubChem CID 90509059) has the molecular formula C20H15N3O6 and a molecular weight of 393.36 g/mol. Its IUPAC name is 3-[3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]azetidine-1-carbonyl]-8-methoxychromen-2-one.
| Compound Name | 3-[3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]azetidine-1-carbonyl]-8-methoxychromen-2-one |
|---|---|
| PubChem CID | 90509059 |
| Molecular Formula | C20H15N3O6 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 3-[3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]azetidine-1-carbonyl]-8-methoxychromen-2-one |
| SMILES | COc1cccc2cc(C(=O)N3CC(c4nc(-c5ccco5)no4)C3)c(=O)oc12 |
| InChI | InChI=1S/C20H15N3O6/c1-26-14-5-2-4-11-8-13(20(25)28-16(11)14)19(24)23-9-12(10-23)18-21-17(22-29-18)15-6-3-7-27-15/h2-8,12H,9-10H2,1H3 |
| InChIKey | RZJZHJXZGVFXHU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 111.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|