C14H14N2O2S2 — CID 90511056
1-(thiophene-2-carbonyl)-N-(thiophen-2-ylmethyl)azetidine-3-carboxamide (PubChem CID 90511056) has the molecular formula C14H14N2O2S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-(thiophene-2-carbonyl)-N-(thiophen-2-ylmethyl)azetidine-3-carboxamide.
| Compound Name | 1-(thiophene-2-carbonyl)-N-(thiophen-2-ylmethyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 90511056 |
| Molecular Formula | C14H14N2O2S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 1-(thiophene-2-carbonyl)-N-(thiophen-2-ylmethyl)azetidine-3-carboxamide |
| SMILES | O=C(NCc1cccs1)C1CN(C(=O)c2cccs2)C1 |
| InChI | InChI=1S/C14H14N2O2S2/c17-13(15-7-11-3-1-5-19-11)10-8-16(9-10)14(18)12-4-2-6-20-12/h1-6,10H,7-9H2,(H,15,17) |
| InChIKey | QLCMHNQICAJHAV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |