C15H23N3O4 — CID 90511361
1-(5-methyl-1,2-oxazole-3-carbonyl)-N-(3-propan-2-yloxypropyl)azetidine-3-carboxamide (PubChem CID 90511361) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-(5-methyl-1,2-oxazole-3-carbonyl)-N-(3-propan-2-yloxypropyl)azetidine-3-carboxamide.
| Compound Name | 1-(5-methyl-1,2-oxazole-3-carbonyl)-N-(3-propan-2-yloxypropyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 90511361 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1-(5-methyl-1,2-oxazole-3-carbonyl)-N-(3-propan-2-yloxypropyl)azetidine-3-carboxamide |
| SMILES | Cc1cc(C(=O)N2CC(C(=O)NCCCOC(C)C)C2)no1 |
| InChI | InChI=1S/C15H23N3O4/c1-10(2)21-6-4-5-16-14(19)12-8-18(9-12)15(20)13-7-11(3)22-17-13/h7,10,12H,4-6,8-9H2,1-3H3,(H,16,19) |
| InChIKey | PNHPLGDOPOHZBK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|