C15H19N3O3 — CID 90511554
1-(5-methyl-1,2-oxazole-3-carbonyl)-N,N-bis(prop-2-enyl)azetidine-3-carboxamide (PubChem CID 90511554) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 1-(5-methyl-1,2-oxazole-3-carbonyl)-N,N-bis(prop-2-enyl)azetidine-3-carboxamide.
| Compound Name | 1-(5-methyl-1,2-oxazole-3-carbonyl)-N,N-bis(prop-2-enyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 90511554 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-(5-methyl-1,2-oxazole-3-carbonyl)-N,N-bis(prop-2-enyl)azetidine-3-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)C1CN(C(=O)c2cc(C)on2)C1 |
| InChI | InChI=1S/C15H19N3O3/c1-4-6-17(7-5-2)14(19)12-9-18(10-12)15(20)13-8-11(3)21-16-13/h4-5,8,12H,1-2,6-7,9-10H2,3H3 |
| InChIKey | VVOGIWFFDUMMGJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|