C22H23N3O3 — CID 90511870
1-(1H-indole-3-carbonyl)-N-[2-(3-methoxyphenyl)ethyl]azetidine-3-carboxamide (PubChem CID 90511870) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 1-(1H-indole-3-carbonyl)-N-[2-(3-methoxyphenyl)ethyl]azetidine-3-carboxamide.
| Compound Name | 1-(1H-indole-3-carbonyl)-N-[2-(3-methoxyphenyl)ethyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 90511870 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1-(1H-indole-3-carbonyl)-N-[2-(3-methoxyphenyl)ethyl]azetidine-3-carboxamide |
| SMILES | COc1cccc(CCNC(=O)C2CN(C(=O)c3c[nH]c4ccccc34)C2)c1 |
| InChI | InChI=1S/C22H23N3O3/c1-28-17-6-4-5-15(11-17)9-10-23-21(26)16-13-25(14-16)22(27)19-12-24-20-8-3-2-7-18(19)20/h2-8,11-12,16,24H,9-10,13-14H2,1H3,(H,23,26) |
| InChIKey | YEPRTQVKNUIRDH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |